Description
A cytidine 5'-phosphate obtained by formal condensation of the phosphate group of CMP with the phosphono group of phosphonoformic acid.
Chemical properties
| Chemical formula | Net charge | Average mass |
|---|---|---|
| C10H15N3O12P2 | 0 | 431.187 |
Nomenclature
| IUPAC | SMILES | InChI | InChIKey | Synonyms |
|---|---|---|---|---|
| 5'-O-[{[carboxy(hydroxy)phosphoryl]oxy}(hydroxy)phosphoryl]cytidine | O=P(OP(C(O)=O)(=O)O)(O)OC[C@H]1O[C@@H](N2C(N=C(C=C2)N)=O)[C@@H]([C@@H]1O)O | InChI=1S/C10H15N3O12P2/c11-5-1-2-13(9(16)12-5)8-7(15)6(14)4(24-8)3-23-27(21,22)25-26(19,20)10(17)18/h1-2,4,6-8,14-15H,3H2,(H,17,18)(H,19,20)(H,21,22)(H2,11,12,16)/t4-,6-,7-,8-/m1/s1 | UKMKGKZFTWPAOJ-XVFCMESISA-N |
|
Citations
- Blodgett, JA, et al. 2007. Unusual transformations in the biosynthesis of the antibiotic phosphinothricin tripeptide. Nature Chemical Biology. 3(8).